C17H22N2O — CID 18104801
6-methyl-N-propyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 18104801) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 6-methyl-N-propyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 6-methyl-N-propyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 18104801 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 6-methyl-N-propyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc2[nH]c3c(c2c1)CC(C)CC3 |
| InChI | InChI=1S/C17H22N2O/c1-3-8-18-17(20)12-5-7-16-14(10-12)13-9-11(2)4-6-15(13)19-16/h5,7,10-11,19H,3-4,6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | PADRRLVZGDLGDV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|