C14H14NO2- — CID 4052175
6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 4052175) has the molecular formula C14H14NO2- and a molecular weight of 228.27 g/mol. Its IUPAC name is 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 4052175 |
| Molecular Formula | C14H14NO2- |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CC1CCc2[nH]c3ccc(C(=O)[O-])cc3c2C1 |
| InChI | InChI=1S/C14H15NO2/c1-8-2-4-12-10(6-8)11-7-9(14(16)17)3-5-13(11)15-12/h3,5,7-8,15H,2,4,6H2,1H3,(H,16,17)/p-1 |
| InChIKey | WKBUQRILUMGUTL-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|