C17H20NO2- — CID 6930360
(6S)-6-tert-butyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 6930360) has the molecular formula C17H20NO2- and a molecular weight of 270.35 g/mol. Its IUPAC name is (6S)-6-tert-butyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | (6S)-6-tert-butyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 6930360 |
| Molecular Formula | C17H20NO2- |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (6S)-6-tert-butyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CC(C)(C)[C@H]1CCc2[nH]c3ccc(C(=O)[O-])cc3c2C1 |
| InChI | InChI=1S/C17H21NO2/c1-17(2,3)11-5-7-15-13(9-11)12-8-10(16(19)20)4-6-14(12)18-15/h4,6,8,11,18H,5,7,9H2,1-3H3,(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | NXXWVPYKLMIUSJ-NSHDSACASA-M |
| XLogP | 2.68 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|