C16H19N3O2 — CID 17433866
N'-acetyl-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide (PubChem CID 17433866) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N'-acetyl-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide.
| Compound Name | N'-acetyl-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17433866 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N'-acetyl-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
| SMILES | CC(=O)NNC(=O)c1ccc2[nH]c3c(c2c1)CC(C)CC3 |
| InChI | InChI=1S/C16H19N3O2/c1-9-3-5-14-12(7-9)13-8-11(4-6-15(13)17-14)16(21)19-18-10(2)20/h4,6,8-9,17H,3,5,7H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | VIQDMTROEAZYQX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|