C17H17N3OS — CID 2527812
(6S)-6-methyl-N-(1,3-thiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 2527812) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is (6S)-6-methyl-N-(1,3-thiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6S)-6-methyl-N-(1,3-thiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 2527812 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (6S)-6-methyl-N-(1,3-thiazol-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)Nc4nccs4)cc3c2C1 |
| InChI | InChI=1S/C17H17N3OS/c1-10-2-4-14-12(8-10)13-9-11(3-5-15(13)19-14)16(21)20-17-18-6-7-22-17/h3,5-7,9-10,19H,2,4,8H2,1H3,(H,18,20,21)/t10-/m0/s1 |
| InChIKey | YAWNMWDHKFAPLT-JTQLQIEISA-N |
| XLogP | 4.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|