C20H18BrFN2O — CID 2495222
(6R)-N-(4-bromo-2-fluorophenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 2495222) has the molecular formula C20H18BrFN2O and a molecular weight of 401.28 g/mol. Its IUPAC name is (6R)-N-(4-bromo-2-fluorophenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6R)-N-(4-bromo-2-fluorophenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 2495222 |
| Molecular Formula | C20H18BrFN2O |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (6R)-N-(4-bromo-2-fluorophenyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@@H]1CCc2[nH]c3ccc(C(=O)Nc4ccc(Br)cc4F)cc3c2C1 |
| InChI | InChI=1S/C20H18BrFN2O/c1-11-2-5-17-14(8-11)15-9-12(3-6-18(15)23-17)20(25)24-19-7-4-13(21)10-16(19)22/h3-4,6-7,9-11,23H,2,5,8H2,1H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | DUPAHDILZPPUGE-LLVKDONJSA-N |
| XLogP | 5.45 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|