C22H23N3O3 — CID 92516183
(6R)-N'-(4-methoxybenzoyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide (PubChem CID 92516183) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (6R)-N'-(4-methoxybenzoyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide.
| Compound Name | (6R)-N'-(4-methoxybenzoyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
|---|---|
| PubChem CID | 92516183 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (6R)-N'-(4-methoxybenzoyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc3[nH]c4c(c3c2)C[C@H](C)CC4)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-13-3-9-19-17(11-13)18-12-15(6-10-20(18)23-19)22(27)25-24-21(26)14-4-7-16(28-2)8-5-14/h4-8,10,12-13,23H,3,9,11H2,1-2H3,(H,24,26)(H,25,27)/t13-/m1/s1 |
| InChIKey | TXHVUEKJZVPVCI-CYBMUJFWSA-N |
| XLogP | 3.38 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|