C21H28N2O3 — CID 18284651
methyl 4-methyl-2-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]pentanoate (PubChem CID 18284651) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl 4-methyl-2-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 18284651 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | methyl 4-methyl-2-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1ccc2[nH]c3c(c2c1)CC(C)CC3 |
| InChI | InChI=1S/C21H28N2O3/c1-12(2)9-19(21(25)26-4)23-20(24)14-6-8-18-16(11-14)15-10-13(3)5-7-17(15)22-18/h6,8,11-13,19,22H,5,7,9-10H2,1-4H3,(H,23,24) |
| InChIKey | DEJVJTOJGRUBEN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|