C17H23NO — CID 65335189
3-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 65335189) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 3-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 65335189 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3-tert-butyl-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(C(C)(C)C)CC3 |
| InChI | InChI=1S/C17H23NO/c1-17(2,3)11-5-7-15-13(9-11)14-10-12(19-4)6-8-16(14)18-15/h6,8,10-11,18H,5,7,9H2,1-4H3 |
| InChIKey | ONKDIVDIAVHRSM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|