C15H19NO — CID 65335451
6-methoxy-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole (PubChem CID 65335451) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole.
| Compound Name | 6-methoxy-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
|---|---|
| PubChem CID | 65335451 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 6-methoxy-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(C)(C)CC3 |
| InChI | InChI=1S/C15H19NO/c1-15(2)7-6-14-12(9-15)11-8-10(17-3)4-5-13(11)16-14/h4-5,8,16H,6-7,9H2,1-3H3 |
| InChIKey | KJYOESADQDMVDO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|