C20H23ClN2O — CID 70573974
(6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazol-3-yl)methanamine;hydrochloride (PubChem CID 70573974) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is (6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazol-3-yl)methanamine;hydrochloride.
| Compound Name | (6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazol-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 70573974 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazol-3-yl)methanamine;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(CN)(c1ccccc1)CC3.Cl |
| InChI | InChI=1S/C20H22N2O.ClH/c1-23-15-7-8-18-16(11-15)17-12-20(13-21,10-9-19(17)22-18)14-5-3-2-4-6-14;/h2-8,11,22H,9-10,12-13,21H2,1H3;1H |
| InChIKey | PTBUXMDQUHGUOS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|