C15H20N2O — CID 83843557
1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylmethanamine (PubChem CID 83843557) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83843557 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylmethanamine |
| SMILES | CNCC1CCc2[nH]c3ccc(OC)cc3c2C1 |
| InChI | InChI=1S/C15H20N2O/c1-16-9-10-3-5-14-12(7-10)13-8-11(18-2)4-6-15(13)17-14/h4,6,8,10,16-17H,3,5,7,9H2,1-2H3 |
| InChIKey | CPRBRBMUMATKSC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|