C15H19FN2 — CID 143281188
2-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylethanamine (PubChem CID 143281188) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylethanamine.
| Compound Name | 2-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 143281188 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylethanamine |
| SMILES | CNCCC1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C15H19FN2/c1-17-7-6-10-2-4-14-12(8-10)13-9-11(16)3-5-15(13)18-14/h3,5,9-10,17-18H,2,4,6-8H2,1H3 |
| InChIKey | GDRXQXKXKXACDZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|