C16H18FN3O — CID 113096809
1-cyclopropyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea (PubChem CID 113096809) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea.
| Compound Name | 1-cyclopropyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea |
|---|---|
| PubChem CID | 113096809 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-cyclopropyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea |
| SMILES | O=C(NC1CC1)NC1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C16H18FN3O/c17-9-1-5-14-12(7-9)13-8-11(4-6-15(13)20-14)19-16(21)18-10-2-3-10/h1,5,7,10-11,20H,2-4,6,8H2,(H2,18,19,21) |
| InChIKey | NRCIAZDDLQEWTQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|