C15H17FN2O2 — CID 113097176
ethyl N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate (PubChem CID 113097176) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is ethyl N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate.
| Compound Name | ethyl N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
|---|---|
| PubChem CID | 113097176 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | ethyl N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
| SMILES | CCOC(=O)NC1CCc2[nH]c3cc(F)ccc3c2C1 |
| InChI | InChI=1S/C15H17FN2O2/c1-2-20-15(19)17-10-4-6-13-12(8-10)11-5-3-9(16)7-14(11)18-13/h3,5,7,10,18H,2,4,6,8H2,1H3,(H,17,19) |
| InChIKey | HWHWVKARXPRQLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|