C19H24FN3O — CID 113096803
1-cyclohexyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea (PubChem CID 113096803) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea.
| Compound Name | 1-cyclohexyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea |
|---|---|
| PubChem CID | 113096803 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-cyclohexyl-3-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)urea |
| SMILES | O=C(NC1CCCCC1)NC1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C19H24FN3O/c20-12-6-8-17-15(10-12)16-11-14(7-9-18(16)23-17)22-19(24)21-13-4-2-1-3-5-13/h6,8,10,13-14,23H,1-5,7,9,11H2,(H2,21,22,24) |
| InChIKey | FYVSSYJZGAVLCW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|