C19H16F2N2O — CID 113097133
4-fluoro-N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzamide (PubChem CID 113097133) has the molecular formula C19H16F2N2O and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-fluoro-N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzamide.
| Compound Name | 4-fluoro-N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzamide |
|---|---|
| PubChem CID | 113097133 |
| Molecular Formula | C19H16F2N2O |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-fluoro-N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzamide |
| SMILES | O=C(NC1CCc2[nH]c3cc(F)ccc3c2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F2N2O/c20-12-3-1-11(2-4-12)19(24)22-14-6-8-17-16(10-14)15-7-5-13(21)9-18(15)23-17/h1-5,7,9,14,23H,6,8,10H2,(H,22,24) |
| InChIKey | CKLYTFNVZULCKC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|