C21H22FN3O — CID 22611338
N-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide (PubChem CID 22611338) has the molecular formula C21H22FN3O and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide.
| Compound Name | N-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 22611338 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
| SMILES | CCNC1CCc2[nH]c3ccc(NC(=O)c4ccc(F)cc4)cc3c2C1 |
| InChI | InChI=1S/C21H22FN3O/c1-2-23-15-7-9-19-17(11-15)18-12-16(8-10-20(18)25-19)24-21(26)13-3-5-14(22)6-4-13/h3-6,8,10,12,15,23,25H,2,7,9,11H2,1H3,(H,24,26) |
| InChIKey | NZMKVAXIOCXMAT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|