C27H22FN3O3 — CID 70275523
N-[6-(1,3-dioxo-7aH-isoindol-3a-yl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide (PubChem CID 70275523) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[6-(1,3-dioxo-7aH-isoindol-3a-yl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide.
| Compound Name | N-[6-(1,3-dioxo-7aH-isoindol-3a-yl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 70275523 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[6-(1,3-dioxo-7aH-isoindol-3a-yl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc2[nH]c3c(c2c1)CC(C12C=CC=CC1C(=O)NC2=O)CC3)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H22FN3O3/c28-17-7-4-15(5-8-17)24(32)29-18-9-11-23-20(14-18)19-13-16(6-10-22(19)30-23)27-12-2-1-3-21(27)25(33)31-26(27)34/h1-5,7-9,11-12,14,16,21,30H,6,10,13H2,(H,29,32)(H,31,33,34) |
| InChIKey | PPSZCMVJUSYEMG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|