C27H26FN3O3S — CID 4837245
N-[3-[(4-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 4837245) has the molecular formula C27H26FN3O3S and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 4837245 |
| Molecular Formula | C27H26FN3O3S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[3-[(4-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CC(C)CC4)cc1S(=O)(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FN3O3S/c1-16-3-11-24-22(13-16)23-14-18(5-12-25(23)30-24)27(32)29-21-8-4-17(2)26(15-21)35(33,34)31-20-9-6-19(28)7-10-20/h4-10,12,14-16,30-31H,3,11,13H2,1-2H3,(H,29,32) |
| InChIKey | DIGKMTVGYFZGDW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|