C20H21N3O3S — CID 46809541
N-(4-methyl-3-sulfamoylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 46809541) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 46809541 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)cc1S(N)(=O)=O |
| InChI | InChI=1S/C20H21N3O3S/c1-12-6-8-14(11-19(12)27(21,25)26)22-20(24)13-7-9-18-16(10-13)15-4-2-3-5-17(15)23-18/h6-11,23H,2-5H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | JURXMMRFXUVDCC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|