C24H25N3O2 — CID 166220279
N-(2-methyl-1-oxo-3,4-dihydroisoquinolin-7-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide (PubChem CID 166220279) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(2-methyl-1-oxo-3,4-dihydroisoquinolin-7-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide.
| Compound Name | N-(2-methyl-1-oxo-3,4-dihydroisoquinolin-7-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
|---|---|
| PubChem CID | 166220279 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(2-methyl-1-oxo-3,4-dihydroisoquinolin-7-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
| SMILES | CN1CCc2ccc(NC(=O)c3ccc4[nH]c5c(c4c3)CCCCC5)cc2C1=O |
| InChI | InChI=1S/C24H25N3O2/c1-27-12-11-15-7-9-17(14-19(15)24(27)29)25-23(28)16-8-10-22-20(13-16)18-5-3-2-4-6-21(18)26-22/h7-10,13-14,26H,2-6,11-12H2,1H3,(H,25,28) |
| InChIKey | KPWGUKLKFNAQFJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|