C20H21N3O — CID 47027656
N-(4-methyl-2-pyridinyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide (PubChem CID 47027656) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
|---|---|
| PubChem CID | 47027656 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2ccc3[nH]c4c(c3c2)CCCCC4)c1 |
| InChI | InChI=1S/C20H21N3O/c1-13-9-10-21-19(11-13)23-20(24)14-7-8-18-16(12-14)15-5-3-2-4-6-17(15)22-18/h7-12,22H,2-6H2,1H3,(H,21,23,24) |
| InChIKey | SNWMRAOZQDQUFQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|