C12H13N — CID 4770206
7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 4770206) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 4770206 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC3 |
| InChI | InChI=1S/C12H13N/c1-8-5-6-12-10(7-8)9-3-2-4-11(9)13-12/h5-7,13H,2-4H2,1H3 |
| InChIKey | XSPVKGRMUCWWSM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|