C14H17NO — CID 2874344
2-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-ol (PubChem CID 2874344) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-ol.
| Compound Name | 2-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-ol |
|---|---|
| PubChem CID | 2874344 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-ol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCCC3O |
| InChI | InChI=1S/C14H17NO/c1-9-6-7-12-11(8-9)10-4-2-3-5-13(16)14(10)15-12/h6-8,13,15-16H,2-5H2,1H3 |
| InChIKey | ZSUMOIQSYGLLID-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |