C20H29N2+ — CID 7372508
cyclohexyl-[(1R)-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-yl]azanium (PubChem CID 7372508) has the molecular formula C20H29N2+ and a molecular weight of 297.47 g/mol. Its IUPAC name is cyclohexyl-[(1R)-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-yl]azanium.
| Compound Name | cyclohexyl-[(1R)-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-yl]azanium |
|---|---|
| PubChem CID | 7372508 |
| Molecular Formula | C20H29N2+ |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | cyclohexyl-[(1R)-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-yl]azanium |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC[C@@]3(C)[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C20H28N2/c1-14-10-11-18-17(13-14)16-9-6-12-20(2,19(16)21-18)22-15-7-4-3-5-8-15/h10-11,13,15,21-22H,3-9,12H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | BUQQQAKIMTZBMC-HXUWFJFHSA-O |
| XLogP | 3.92 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |