C20H28N2 — CID 1385546
(1S)-N-cyclohexyl-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-amine (PubChem CID 1385546) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (1S)-N-cyclohexyl-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-amine.
| Compound Name | (1S)-N-cyclohexyl-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-amine |
|---|---|
| PubChem CID | 1385546 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (1S)-N-cyclohexyl-1,6-dimethyl-2,3,4,9-tetrahydrocarbazol-1-amine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC[C@]3(C)NC1CCCCC1 |
| InChI | InChI=1S/C20H28N2/c1-14-10-11-18-17(13-14)16-9-6-12-20(2,19(16)21-18)22-15-7-4-3-5-8-15/h10-11,13,15,21-22H,3-9,12H2,1-2H3/t20-/m0/s1 |
| InChIKey | BUQQQAKIMTZBMC-FQEVSTJZSA-N |
| XLogP | 4.95 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |