C19H27N2+ — CID 4105832
cyclohexyl-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)azanium (PubChem CID 4105832) has the molecular formula C19H27N2+ and a molecular weight of 283.44 g/mol. Its IUPAC name is cyclohexyl-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)azanium.
| Compound Name | cyclohexyl-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)azanium |
|---|---|
| PubChem CID | 4105832 |
| Molecular Formula | C19H27N2+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | cyclohexyl-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)azanium |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCC3[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C19H26N2/c1-13-10-11-17-16(12-13)15-8-5-9-18(19(15)21-17)20-14-6-3-2-4-7-14/h10-12,14,18,20-21H,2-9H2,1H3/p+1 |
| InChIKey | UEUQYLXESARPGR-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|