C18H29N3+2 — CID 2004357
dimethyl-[3-[[(1S)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azaniumyl]propyl]azanium (PubChem CID 2004357) has the molecular formula C18H29N3+2 and a molecular weight of 287.45 g/mol. Its IUPAC name is dimethyl-[3-[[(1S)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azaniumyl]propyl]azanium.
| Compound Name | dimethyl-[3-[[(1S)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azaniumyl]propyl]azanium |
|---|---|
| PubChem CID | 2004357 |
| Molecular Formula | C18H29N3+2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | dimethyl-[3-[[(1S)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azaniumyl]propyl]azanium |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC[C@@H]3[NH2+]CCC[NH+](C)C |
| InChI | InChI=1S/C18H27N3/c1-13-8-9-16-15(12-13)14-6-4-7-17(18(14)20-16)19-10-5-11-21(2)3/h8-9,12,17,19-20H,4-7,10-11H2,1-3H3/p+2/t17-/m0/s1 |
| InChIKey | ABYBKVTTZUTOKN-KRWDZBQOSA-P |
| XLogP | 0.95 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|