C20H22ClN2+ — CID 7047389
(4-chlorophenyl)methyl-[(1R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium (PubChem CID 7047389) has the molecular formula C20H22ClN2+ and a molecular weight of 325.86 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-[(1R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium.
| Compound Name | (4-chlorophenyl)methyl-[(1R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium |
|---|---|
| PubChem CID | 7047389 |
| Molecular Formula | C20H22ClN2+ |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (4-chlorophenyl)methyl-[(1R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC[C@H]3[NH2+]Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2/c1-13-5-10-18-17(11-13)16-3-2-4-19(20(16)23-18)22-12-14-6-8-15(21)9-7-14/h5-11,19,22-23H,2-4,12H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | IMZVYMDQVZARAQ-LJQANCHMSA-O |
| XLogP | 4.27 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|