C26H32N3O2+ — CID 2180633
[(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[2-(4-nitrophenyl)ethyl]azanium (PubChem CID 2180633) has the molecular formula C26H32N3O2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is [(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[2-(4-nitrophenyl)ethyl]azanium.
| Compound Name | [(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[2-(4-nitrophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2180633 |
| Molecular Formula | C26H32N3O2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[2-(4-nitrophenyl)ethyl]azanium |
| SMILES | O=[N+]([O-])c1ccc(CC[NH2+][C@H]2CCCc3c2[nH]c2ccc(C4CCCCC4)cc32)cc1 |
| InChI | InChI=1S/C26H31N3O2/c30-29(31)21-12-9-18(10-13-21)15-16-27-25-8-4-7-22-23-17-20(19-5-2-1-3-6-19)11-14-24(23)28-26(22)25/h9-14,17,19,25,27-28H,1-8,15-16H2/p+1/t25-/m0/s1 |
| InChIKey | GBNLDDIXLMLCNJ-VWLOTQADSA-O |
| XLogP | 5.31 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|