C22H25N3O3 — CID 7463671
(1R)-N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 7463671) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1R)-N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | (1R)-N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 7463671 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (1R)-N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | COc1ccc(C[C@@H](C)N[C@@H]2CCCc3c2[nH]c2ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-14(12-15-6-9-17(28-2)10-7-15)23-21-5-3-4-18-19-13-16(25(26)27)8-11-20(19)24-22(18)21/h6-11,13-14,21,23-24H,3-5,12H2,1-2H3/t14-,21-/m1/s1 |
| InChIKey | LXHZPHAZKBPJHO-SPLOXXLWSA-N |
| XLogP | 4.68 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|