C18H24N2O2 — CID 99995344
N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-methylbutanamide (PubChem CID 99995344) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-methylbutanamide.
| Compound Name | N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 99995344 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-methylbutanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@H]3NC(=O)CC(C)C |
| InChI | InChI=1S/C18H24N2O2/c1-11(2)9-17(21)19-16-6-4-5-13-14-10-12(22-3)7-8-15(14)20-18(13)16/h7-8,10-11,16,20H,4-6,9H2,1-3H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | NOGLXKGDXJJLCC-MRXNPFEDSA-N |
| XLogP | 3.72 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|