C21H28N2O2S2 — CID 110206472
5-[(3R)-dithiolan-3-yl]-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pentanamide (PubChem CID 110206472) has the molecular formula C21H28N2O2S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pentanamide |
|---|---|
| PubChem CID | 110206472 |
| Molecular Formula | C21H28N2O2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pentanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCCC3NC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C21H28N2O2S2/c1-25-14-9-10-18-17(13-14)16-6-4-7-19(21(16)23-18)22-20(24)8-3-2-5-15-11-12-26-27-15/h9-10,13,15,19,23H,2-8,11-12H2,1H3,(H,22,24)/t15-,19?/m1/s1 |
| InChIKey | UZOGNMXKVQWVGY-NYRJJRHWSA-N |
| XLogP | 5.38 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|