C25H27N3O3 — CID 97489350
3-(4-methoxyindol-1-yl)-N-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]propanamide (PubChem CID 97489350) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(4-methoxyindol-1-yl)-N-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]propanamide.
| Compound Name | 3-(4-methoxyindol-1-yl)-N-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]propanamide |
|---|---|
| PubChem CID | 97489350 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-(4-methoxyindol-1-yl)-N-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]propanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@@H]3NC(=O)CCn1ccc2c(OC)cccc21 |
| InChI | InChI=1S/C25H27N3O3/c1-30-16-9-10-20-19(15-16)17-5-3-6-21(25(17)27-20)26-24(29)12-14-28-13-11-18-22(28)7-4-8-23(18)31-2/h4,7-11,13,15,21,27H,3,5-6,12,14H2,1-2H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | BFKKJPDLTVQJCK-NRFANRHFSA-N |
| XLogP | 4.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|