C22H23N3O3 — CID 124877959
N-[2-[[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]-2-oxoethyl]benzamide (PubChem CID 124877959) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[2-[[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 124877959 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[2-[[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]-2-oxoethyl]benzamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@H]3NC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-15-10-11-18-17(12-15)16-8-5-9-19(21(16)25-18)24-20(26)13-23-22(27)14-6-3-2-4-7-14/h2-4,6-7,10-12,19,25H,5,8-9,13H2,1H3,(H,23,27)(H,24,26)/t19-/m1/s1 |
| InChIKey | JSKLZVPWOUTSPN-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|