C22H25N3O2 — CID 125122227
1-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-(2-phenylethyl)urea (PubChem CID 125122227) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 125122227 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[(1S)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-(2-phenylethyl)urea |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@@H]3NC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2/c1-27-16-10-11-19-18(14-16)17-8-5-9-20(21(17)24-19)25-22(26)23-13-12-15-6-3-2-4-7-15/h2-4,6-7,10-11,14,20,24H,5,8-9,12-13H2,1H3,(H2,23,25,26)/t20-/m0/s1 |
| InChIKey | GIWVKBNIPLPJGW-FQEVSTJZSA-N |
| XLogP | 4.10 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|