C22H23N3O4 — CID 125123129
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]urea (PubChem CID 125123129) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]urea |
|---|---|
| PubChem CID | 125123129 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]urea |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@H]3NC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H23N3O4/c1-27-14-6-7-17-16(10-14)15-3-2-4-18(21(15)24-17)25-22(26)23-11-13-5-8-19-20(9-13)29-12-28-19/h5-10,18,24H,2-4,11-12H2,1H3,(H2,23,25,26)/t18-/m1/s1 |
| InChIKey | VXCVCMBTXZQTDO-GOSISDBHSA-N |
| XLogP | 3.78 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|