C23H23N3O3 — CID 110208093
4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-2-carboxamide (PubChem CID 110208093) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-2-carboxamide.
| Compound Name | 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110208093 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCCC3NC(=O)c1cc2c(OC)cccc2[nH]1 |
| InChI | InChI=1S/C23H23N3O3/c1-28-13-9-10-18-15(11-13)14-5-3-7-19(22(14)25-18)26-23(27)20-12-16-17(24-20)6-4-8-21(16)29-2/h4,6,8-12,19,24-25H,3,5,7H2,1-2H3,(H,26,27) |
| InChIKey | BVQUTODOSRDXLI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|