C24H25N3O2S — CID 125124207
(3R)-N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide (PubChem CID 125124207) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide.
| Compound Name | (3R)-N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 125124207 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (3R)-N-[(1R)-6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCC[C@H]3NC(=O)C[C@H](c1ccsc1)n1cccc1 |
| InChI | InChI=1S/C24H25N3O2S/c1-29-17-7-8-20-19(13-17)18-5-4-6-21(24(18)26-20)25-23(28)14-22(16-9-12-30-15-16)27-10-2-3-11-27/h2-3,7-13,15,21-22,26H,4-6,14H2,1H3,(H,25,28)/t21-,22-/m1/s1 |
| InChIKey | XWRQUSZHVMDIKX-FGZHOGPDSA-N |
| XLogP | 5.21 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|