C22H26N3O3+ — CID 7463689
[(2R)-1-(2-methoxyphenyl)propan-2-yl]-[(1S)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium (PubChem CID 7463689) has the molecular formula C22H26N3O3+ and a molecular weight of 380.47 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyphenyl)propan-2-yl]-[(1S)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium.
| Compound Name | [(2R)-1-(2-methoxyphenyl)propan-2-yl]-[(1S)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium |
|---|---|
| PubChem CID | 7463689 |
| Molecular Formula | C22H26N3O3+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(2R)-1-(2-methoxyphenyl)propan-2-yl]-[(1S)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]azanium |
| SMILES | COc1ccccc1C[C@@H](C)[NH2+][C@H]1CCCc2c1[nH]c1ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H25N3O3/c1-14(12-15-6-3-4-9-21(15)28-2)23-20-8-5-7-17-18-13-16(25(26)27)10-11-19(18)24-22(17)20/h3-4,6,9-11,13-14,20,23-24H,5,7-8,12H2,1-2H3/p+1/t14-,20+/m1/s1 |
| InChIKey | OQVIKUTVCLJXEI-VLIAUNLRSA-O |
| XLogP | 3.66 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|