C22H26N3O2+ — CID 7463718
[(1R)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[(2R)-4-phenylbutan-2-yl]azanium (PubChem CID 7463718) has the molecular formula C22H26N3O2+ and a molecular weight of 364.47 g/mol. Its IUPAC name is [(1R)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[(2R)-4-phenylbutan-2-yl]azanium.
| Compound Name | [(1R)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[(2R)-4-phenylbutan-2-yl]azanium |
|---|---|
| PubChem CID | 7463718 |
| Molecular Formula | C22H26N3O2+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(1R)-6-nitro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-[(2R)-4-phenylbutan-2-yl]azanium |
| SMILES | C[C@H](CCc1ccccc1)[NH2+][C@@H]1CCCc2c1[nH]c1ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H25N3O2/c1-15(10-11-16-6-3-2-4-7-16)23-21-9-5-8-18-19-14-17(25(26)27)12-13-20(19)24-22(18)21/h2-4,6-7,12-15,21,23-24H,5,8-11H2,1H3/p+1/t15-,21-/m1/s1 |
| InChIKey | HHKCYPWQJKYAMI-QVKFZJNVSA-O |
| XLogP | 4.04 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|