C19H24N2O — CID 755453
N-[(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide (PubChem CID 755453) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide.
| Compound Name | N-[(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide |
|---|---|
| PubChem CID | 755453 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[(1S)-6-cyclohexyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide |
| SMILES | O=CN[C@H]1CCCc2c1[nH]c1ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C19H24N2O/c22-12-20-18-8-4-7-15-16-11-14(13-5-2-1-3-6-13)9-10-17(16)21-19(15)18/h9-13,18,21H,1-8H2,(H,20,22)/t18-/m0/s1 |
| InChIKey | HTUPZBSTRZGLFL-SFHVURJKSA-N |
| XLogP | 4.34 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|