C17H22N2 — CID 65333592
N-cyclopentyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333592) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-cyclopentyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-cyclopentyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333592 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-cyclopentyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | c1ccc2c3c([nH]c2c1)C(NC1CCCC1)CCC3 |
| InChI | InChI=1S/C17H22N2/c1-2-7-12(6-1)18-16-11-5-9-14-13-8-3-4-10-15(13)19-17(14)16/h3-4,8,10,12,16,18-19H,1-2,5-7,9,11H2 |
| InChIKey | WDUQGEOKYLJZMH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|