C15H18N2O2 — CID 65333695
methyl 2-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)acetate (PubChem CID 65333695) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl 2-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)acetate.
| Compound Name | methyl 2-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)acetate |
|---|---|
| PubChem CID | 65333695 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | methyl 2-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)acetate |
| SMILES | COC(=O)CNC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C15H18N2O2/c1-19-14(18)9-16-13-8-4-6-11-10-5-2-3-7-12(10)17-15(11)13/h2-3,5,7,13,16-17H,4,6,8-9H2,1H3 |
| InChIKey | XWIAKDRGVUVWSL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|