C18H26N2 — CID 65333957
N-(4-methylpentyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333957) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(4-methylpentyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-(4-methylpentyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333957 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-(4-methylpentyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CC(C)CCCNC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H26N2/c1-13(2)7-6-12-19-17-11-5-9-15-14-8-3-4-10-16(14)20-18(15)17/h3-4,8,10,13,17,19-20H,5-7,9,11-12H2,1-2H3 |
| InChIKey | MDWLBDQPKRFULR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|