C23H26N2 — CID 176892760
N-[2-(4-cyclopropylphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 176892760) has the molecular formula C23H26N2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[2-(4-cyclopropylphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-[2-(4-cyclopropylphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 176892760 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[2-(4-cyclopropylphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | c1ccc2c3c([nH]c2c1)C(NCCc1ccc(C2CC2)cc1)CCC3 |
| InChI | InChI=1S/C23H26N2/c1-2-6-21-19(4-1)20-5-3-7-22(23(20)25-21)24-15-14-16-8-10-17(11-9-16)18-12-13-18/h1-2,4,6,8-11,18,22,24-25H,3,5,7,12-15H2 |
| InChIKey | MTFYCXOXNVUWKZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|