C20H21BrN2 — CID 2177287
(1R)-6-bromo-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 2177287) has the molecular formula C20H21BrN2 and a molecular weight of 369.31 g/mol. Its IUPAC name is (1R)-6-bromo-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | (1R)-6-bromo-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 2177287 |
| Molecular Formula | C20H21BrN2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (1R)-6-bromo-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCC[C@H]3NCCc1ccccc1 |
| InChI | InChI=1S/C20H21BrN2/c21-15-9-10-18-17(13-15)16-7-4-8-19(20(16)23-18)22-12-11-14-5-2-1-3-6-14/h1-3,5-6,9-10,13,19,22-23H,4,7-8,11-12H2/t19-/m1/s1 |
| InChIKey | TZMBEIZTFFHEHF-LJQANCHMSA-N |
| XLogP | 5.14 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|