C15H19BrN2 — CID 142505549
6-bromo-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 142505549) has the molecular formula C15H19BrN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 6-bromo-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-bromo-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 142505549 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-bromo-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CC(C)NC1CCCc2c1[nH]c1ccc(Br)cc21 |
| InChI | InChI=1S/C15H19BrN2/c1-9(2)17-14-5-3-4-11-12-8-10(16)6-7-13(12)18-15(11)14/h6-9,14,17-18H,3-5H2,1-2H3 |
| InChIKey | YNFCRVXKOYMKEQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|