C17H18BrN3 — CID 143326420
6-bromo-N-(3,4-dihydropyridin-6-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 143326420) has the molecular formula C17H18BrN3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 6-bromo-N-(3,4-dihydropyridin-6-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-bromo-N-(3,4-dihydropyridin-6-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 143326420 |
| Molecular Formula | C17H18BrN3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 6-bromo-N-(3,4-dihydropyridin-6-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCCC3NC1=CCCC=N1 |
| InChI | InChI=1S/C17H18BrN3/c18-11-7-8-14-13(10-11)12-4-3-5-15(17(12)21-14)20-16-6-1-2-9-19-16/h6-10,15,20-21H,1-5H2 |
| InChIKey | HCBYZVPZYRRBFU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|